C32H62N2O3 — CID 166830264
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethyl-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoate (PubChem CID 166830264) has the molecular formula C32H62N2O3 and a molecular weight of 522.86 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethyl-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethyl-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoate |
|---|---|
| PubChem CID | 166830264 |
| Molecular Formula | C32H62N2O3 |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.48 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethyl-10-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxydecanoate |
| SMILES | CCC(CCCCCCCCOC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C32H62N2O3/c1-12-25(28(35)37-27-23-31(6,7)34(11)32(8,9)24-27)19-17-15-13-14-16-18-20-36-26-21-29(2,3)33(10)30(4,5)22-26/h25-27H,12-24H2,1-11H3 |
| InChIKey | XAJOFUXYTPENRO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|