C24H45NO3 — CID 70587590
cyclohexyl 2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]hexanoate (PubChem CID 70587590) has the molecular formula C24H45NO3 and a molecular weight of 395.63 g/mol. Its IUPAC name is cyclohexyl 2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]hexanoate.
| Compound Name | cyclohexyl 2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]hexanoate |
|---|---|
| PubChem CID | 70587590 |
| Molecular Formula | C24H45NO3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.34 |
| IUPAC Name | cyclohexyl 2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]hexanoate |
| SMILES | CCCCC(CCCOC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C24H45NO3/c1-6-7-12-19(22(26)28-20-14-9-8-10-15-20)13-11-16-27-21-17-23(2,3)25-24(4,5)18-21/h19-21,25H,6-18H2,1-5H3 |
| InChIKey | SBTIJLIXQNJFAB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|