C14H30NOSi — CID 22982953
CID 22982953 (PubChem CID 22982953) has the molecular formula C14H30NOSi and a molecular weight of 256.49 g/mol.
| Compound Name | CID 22982953 |
|---|---|
| PubChem CID | 22982953 |
| Molecular Formula | C14H30NOSi |
| Molecular Weight | 256.49 g/mol |
| Exact Mass | 256.21 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCCOC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H30NOSi/c1-13(2)10-12(11-14(3,4)15-13)16-8-7-9-17(5)6/h12,15H,7-11H2,1-6H3 |
| InChIKey | SHXUZCGXYFELAJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|