C15H33NO3Si — CID 71337880
dimethoxymethyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane (PubChem CID 71337880) has the molecular formula C15H33NO3Si and a molecular weight of 303.52 g/mol. Its IUPAC name is dimethoxymethyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane.
| Compound Name | dimethoxymethyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane |
|---|---|
| PubChem CID | 71337880 |
| Molecular Formula | C15H33NO3Si |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | dimethoxymethyl-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]silane |
| SMILES | COC(OC)[SiH2]CCCOC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H33NO3Si/c1-14(2)10-12(11-15(3,4)16-14)19-8-7-9-20-13(17-5)18-6/h12-13,16H,7-11,20H2,1-6H3 |
| InChIKey | LLVULWKAVCGARH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|