C19H39NO — CID 141105994
4-decoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 141105994) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is 4-decoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-decoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 141105994 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 4-decoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCCCCCCCOC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H39NO/c1-6-7-8-9-10-11-12-13-14-21-17-15-18(2,3)20-19(4,5)16-17/h17,20H,6-16H2,1-5H3 |
| InChIKey | BSIOEMSANKMMAD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|