About CID 90849890
CID 90849890 (PubChem CID 90849890) has the molecular formula C14H28NO2
and a molecular weight of 242.38 g/mol.
Molecular Properties
| Compound Name | CID 90849890 |
| PubChem CID | 90849890 |
| Molecular Formula | C14H28NO2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | — |
| SMILES | CCCCCOC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C14H28NO2/c1-6-7-8-9-17-12-10-13(2,3)15(16)14(4,5)11-12/h12H,6-11H2,1-5H3 |
| InChIKey | JYPSHZKOXOYTSB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 90849890 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90849890?
The IUPAC name of CID 90849890 (CID 90849890) is not available.
What is the SMILES notation for CID 90849890?
The canonical SMILES for CID 90849890 is CCCCCOC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 90849890?
The InChIKey is JYPSHZKOXOYTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28NO2/c1-6-7-8-9-17-12-10-13(2,3)15(16)14(4,5)11-12/h12H,6-11H2,1-5H3.
What are the key properties of CID 90849890?
CID 90849890 has a molecular weight of 242.38 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90849890 is sourced from PubChem (CID 90849890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).