C21H42N2O4 — CID 118137024
1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 118137024) has the molecular formula C21H42N2O4 and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 118137024 |
| Molecular Formula | C21H42N2O4 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OCCCOC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H42N2O4/c1-18(2)12-16(13-19(3,4)22(18)24)26-10-9-11-27-17-14-20(5,6)23(25)21(7,8)15-17/h16-17,24-25H,9-15H2,1-8H3 |
| InChIKey | IRCAWQMCFQAGHL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|