C32H59N3O8 — CID 126739205
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]propanedioate (PubChem CID 126739205) has the molecular formula C32H59N3O8 and a molecular weight of 613.84 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]propanedioate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]propanedioate |
|---|---|
| PubChem CID | 126739205 |
| Molecular Formula | C32H59N3O8 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.43 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]propanedioate |
| SMILES | CC1(C)CC(OCCC(C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C32H59N3O8/c1-27(2)15-21(16-28(3,4)33(27)38)41-14-13-24(25(36)42-22-17-29(5,6)34(39)30(7,8)18-22)26(37)43-23-19-31(9,10)35(40)32(11,12)20-23/h21-24,38-40H,13-20H2,1-12H3 |
| InChIKey | QVIVIRRADPTQLX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|