C32H56N2O6 — CID 20778574
bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-heptylpropanedioate (PubChem CID 20778574) has the molecular formula C32H56N2O6 and a molecular weight of 564.81 g/mol. Its IUPAC name is bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-heptylpropanedioate.
| Compound Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-heptylpropanedioate |
|---|---|
| PubChem CID | 20778574 |
| Molecular Formula | C32H56N2O6 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.41 |
| IUPAC Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-heptylpropanedioate |
| SMILES | CCCCCCCC(C(=O)OC1CC(C)(C)N(C(C)=O)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C32H56N2O6/c1-12-13-14-15-16-17-26(27(37)39-24-18-29(4,5)33(22(2)35)30(6,7)19-24)28(38)40-25-20-31(8,9)34(23(3)36)32(10,11)21-25/h24-26H,12-21H2,1-11H3 |
| InChIKey | GIGAWCRRCOWFLQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|