C35H64N4O8 — CID 19892356
bis[1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-butylpropanedioate (PubChem CID 19892356) has the molecular formula C35H64N4O8 and a molecular weight of 668.92 g/mol. Its IUPAC name is bis[1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-butylpropanedioate.
| Compound Name | bis[1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-butylpropanedioate |
|---|---|
| PubChem CID | 19892356 |
| Molecular Formula | C35H64N4O8 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.47 |
| IUPAC Name | bis[1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] 2-butylpropanedioate |
| SMILES | CCCCNC(=O)ON1C(C)(C)CC(OC(=O)C(CCCC)C(=O)OC2CC(C)(C)N(OC(=O)NCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C35H64N4O8/c1-12-15-18-27(28(40)44-25-21-32(4,5)38(33(6,7)22-25)46-30(42)36-19-16-13-2)29(41)45-26-23-34(8,9)39(35(10,11)24-26)47-31(43)37-20-17-14-3/h25-27H,12-24H2,1-11H3,(H,36,42)(H,37,43) |
| InChIKey | NHJLXCFKXRPTKR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|