C34H64N2O6 — CID 156550746
4-O-(1-decoxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate (PubChem CID 156550746) has the molecular formula C34H64N2O6 and a molecular weight of 596.89 g/mol. Its IUPAC name is 4-O-(1-decoxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate.
| Compound Name | 4-O-(1-decoxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate |
|---|---|
| PubChem CID | 156550746 |
| Molecular Formula | C34H64N2O6 |
| Molecular Weight | 596.89 g/mol |
| Exact Mass | 596.48 |
| IUPAC Name | 4-O-(1-decoxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate |
| SMILES | CCCCCCCCCCON1C(C)(C)CC(OC(=O)CCC(=O)OC2CC(C)(C)N(OCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C34H64N2O6/c1-11-13-14-15-16-17-18-19-22-40-36-33(7,8)25-28(26-34(36,9)10)42-30(38)21-20-29(37)41-27-23-31(3,4)35(39-12-2)32(5,6)24-27/h27-28H,11-26H2,1-10H3 |
| InChIKey | DSFJNBJIVVTIAZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|