C53H99N3O10 — CID 123159299
4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl butanedioate;1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate (PubChem CID 123159299) has the molecular formula C53H99N3O10 and a molecular weight of 938.39 g/mol. Its IUPAC name is 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl butanedioate;1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate.
| Compound Name | 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl butanedioate;1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 123159299 |
| Molecular Formula | C53H99N3O10 |
| Molecular Weight | 938.39 g/mol |
| Exact Mass | 937.73 |
| IUPAC Name | 4-O-[2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl] 1-O-methyl butanedioate;1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C.COC(=O)CCC(=O)OCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C37H70N2O5.C16H29NO5/c1-11-12-13-14-19-22-25-42-39-36(6,7)28-31(29-37(39,8)9)44-33(41)24-21-18-16-15-17-20-23-32(40)43-30-26-34(2,3)38(10)35(4,5)27-30;1-15(2)10-12(18)11-16(3,4)17(15)8-9-22-14(20)7-6-13(19)21-5/h30-31H,11-29H2,1-10H3;12,18H,6-11H2,1-5H3 |
| InChIKey | QOXVOLPXNJTOLK-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.39 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|