C39H78N2O6 — CID 159199816
bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) propanedioate;methane (PubChem CID 159199816) has the molecular formula C39H78N2O6 and a molecular weight of 671.06 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) propanedioate;methane.
| Compound Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) propanedioate;methane |
|---|---|
| PubChem CID | 159199816 |
| Molecular Formula | C39H78N2O6 |
| Molecular Weight | 671.06 g/mol |
| Exact Mass | 670.59 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) propanedioate;methane |
| SMILES | C.C.CCCCCCCCON1C(C)(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C37H70N2O6.2CH4/c1-11-13-15-17-19-21-23-42-38-34(3,4)26-30(27-35(38,5)6)44-32(40)25-33(41)45-31-28-36(7,8)39(37(9,10)29-31)43-24-22-20-18-16-14-12-2;;/h30-31H,11-29H2,1-10H3;2*1H4 |
| InChIKey | KPDKJUODINBRKP-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.06 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|