C44H84N2O6 — CID 59518528
(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 9-(6,6,8,8-tetramethyl-7-octoxy-1,2-dioxa-7-azaspiro[3.5]nonan-3-yl)nonanoate (PubChem CID 59518528) has the molecular formula C44H84N2O6 and a molecular weight of 737.16 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 9-(6,6,8,8-tetramethyl-7-octoxy-1,2-dioxa-7-azaspiro[3.5]nonan-3-yl)nonanoate.
| Compound Name | (2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 9-(6,6,8,8-tetramethyl-7-octoxy-1,2-dioxa-7-azaspiro[3.5]nonan-3-yl)nonanoate |
|---|---|
| PubChem CID | 59518528 |
| Molecular Formula | C44H84N2O6 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.63 |
| IUPAC Name | (2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 9-(6,6,8,8-tetramethyl-7-octoxy-1,2-dioxa-7-azaspiro[3.5]nonan-3-yl)nonanoate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)CCCCCCCCC2OOC23CC(C)(C)N(OCCCCCCCC)C(C)(C)C3)CC1(C)C |
| InChI | InChI=1S/C44H84N2O6/c1-11-13-15-17-23-27-31-48-45-40(3,4)33-37(34-41(45,5)6)50-39(47)30-26-22-20-19-21-25-29-38-44(52-51-38)35-42(7,8)46(43(9,10)36-44)49-32-28-24-18-16-14-12-2/h37-38H,11-36H2,1-10H3 |
| InChIKey | HGWZTLBTMGHUQZ-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|