C36H70N4O5 — CID 174906692
dipiperidin-4-yl decanedioate;2,2,6,6-tetramethyl-1-octoxypiperazine (PubChem CID 174906692) has the molecular formula C36H70N4O5 and a molecular weight of 638.98 g/mol. Its IUPAC name is dipiperidin-4-yl decanedioate;2,2,6,6-tetramethyl-1-octoxypiperazine.
| Compound Name | dipiperidin-4-yl decanedioate;2,2,6,6-tetramethyl-1-octoxypiperazine |
|---|---|
| PubChem CID | 174906692 |
| Molecular Formula | C36H70N4O5 |
| Molecular Weight | 638.98 g/mol |
| Exact Mass | 638.53 |
| IUPAC Name | dipiperidin-4-yl decanedioate;2,2,6,6-tetramethyl-1-octoxypiperazine |
| SMILES | CCCCCCCCON1C(C)(C)CNCC1(C)C.O=C(CCCCCCCCC(=O)OC1CCNCC1)OC1CCNCC1 |
| InChI | InChI=1S/C20H36N2O4.C16H34N2O/c23-19(25-17-9-13-21-14-10-17)7-5-3-1-2-4-6-8-20(24)26-18-11-15-22-16-12-18;1-6-7-8-9-10-11-12-19-18-15(2,3)13-17-14-16(18,4)5/h17-18,21-22H,1-16H2;17H,6-14H2,1-5H3 |
| InChIKey | ODJCXEOXRRBGFX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.98 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|