C37H70N2O5 — CID 90713929
10-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl) decanedioate (PubChem CID 90713929) has the molecular formula C37H70N2O5 and a molecular weight of 622.98 g/mol. Its IUPAC name is 10-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl) decanedioate.
| Compound Name | 10-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl) decanedioate |
|---|---|
| PubChem CID | 90713929 |
| Molecular Formula | C37H70N2O5 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.53 |
| IUPAC Name | 10-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl) decanedioate |
| SMILES | CCCCCCCCON1C(C)(C)CCC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C1(C)C |
| InChI | InChI=1S/C37H70N2O5/c1-11-12-13-14-19-22-27-42-39-34(2,3)26-25-31(37(39,8)9)44-33(41)24-21-18-16-15-17-20-23-32(40)43-30-28-35(4,5)38(10)36(6,7)29-30/h30-31H,11-29H2,1-10H3 |
| InChIKey | BCQFMWRUBKJYMO-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|