C42H80N2O5 — CID 122414841
10-O-(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 1-O-(2,2,7,7-tetramethyl-1-octoxyazepan-4-yl) decanedioate (PubChem CID 122414841) has the molecular formula C42H80N2O5 and a molecular weight of 693.11 g/mol. Its IUPAC name is 10-O-(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 1-O-(2,2,7,7-tetramethyl-1-octoxyazepan-4-yl) decanedioate.
| Compound Name | 10-O-(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 1-O-(2,2,7,7-tetramethyl-1-octoxyazepan-4-yl) decanedioate |
|---|---|
| PubChem CID | 122414841 |
| Molecular Formula | C42H80N2O5 |
| Molecular Weight | 693.11 g/mol |
| Exact Mass | 692.61 |
| IUPAC Name | 10-O-(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 1-O-(2,2,7,7-tetramethyl-1-octoxyazepan-4-yl) decanedioate |
| SMILES | CCCCCCCCON1C(C)(C)CCC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(CCCCCC)C2(C)C)CC1(C)C |
| InChI | InChI=1S/C42H80N2O5/c1-11-13-15-17-22-26-32-47-44-39(3,4)30-29-35(33-41(44,7)8)48-37(45)27-23-20-18-19-21-24-28-38(46)49-36-34-40(5,6)43(42(36,9)10)31-25-16-14-12-2/h35-36H,11-34H2,1-10H3 |
| InChIKey | IILCGOVTNUZXCV-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.11 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|