C17H33NO3 — CID 122414780
(2,2,5,5-tetramethyl-1-propoxypyrrolidin-3-yl) hexanoate (PubChem CID 122414780) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is (2,2,5,5-tetramethyl-1-propoxypyrrolidin-3-yl) hexanoate.
| Compound Name | (2,2,5,5-tetramethyl-1-propoxypyrrolidin-3-yl) hexanoate |
|---|---|
| PubChem CID | 122414780 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | (2,2,5,5-tetramethyl-1-propoxypyrrolidin-3-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1CC(C)(C)N(OCCC)C1(C)C |
| InChI | InChI=1S/C17H33NO3/c1-7-9-10-11-15(19)21-14-13-16(3,4)18(17(14,5)6)20-12-8-2/h14H,7-13H2,1-6H3 |
| InChIKey | WIEBISYDTISPNV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|