C21H41NO4 — CID 67968303
[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] octanoate (PubChem CID 67968303) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is [1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] octanoate.
| Compound Name | [1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] octanoate |
|---|---|
| PubChem CID | 67968303 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | [1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1 |
| InChI | InChI=1S/C21H41NO4/c1-8-9-10-11-12-13-18(23)26-17-14-19(2,3)22(20(4,5)15-17)25-16-21(6,7)24/h17,24H,8-16H2,1-7H3 |
| InChIKey | HHGZPLFTPFKLKM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|