C24H45NO6 — CID 22255858
10-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl decanedioate (PubChem CID 22255858) has the molecular formula C24H45NO6 and a molecular weight of 443.63 g/mol. Its IUPAC name is 10-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl decanedioate.
| Compound Name | 10-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl decanedioate |
|---|---|
| PubChem CID | 22255858 |
| Molecular Formula | C24H45NO6 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | 10-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl decanedioate |
| SMILES | COC(=O)CCCCCCCCC(=O)OC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1 |
| InChI | InChI=1S/C24H45NO6/c1-22(2)16-19(17-23(3,4)25(22)30-18-24(5,6)28)31-21(27)15-13-11-9-8-10-12-14-20(26)29-7/h19,28H,8-18H2,1-7H3 |
| InChIKey | NTGLWSXCQSEMIJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|