C19H35NO4 — CID 164740961
1-O-methyl 8-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) octanedioate (PubChem CID 164740961) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 1-O-methyl 8-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) octanedioate.
| Compound Name | 1-O-methyl 8-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) octanedioate |
|---|---|
| PubChem CID | 164740961 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 1-O-methyl 8-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) octanedioate |
| SMILES | COC(=O)CCCCCCC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C19H35NO4/c1-18(2)13-15(14-19(3,4)20(18)5)24-17(22)12-10-8-7-9-11-16(21)23-6/h15H,7-14H2,1-6H3 |
| InChIKey | FOVXHAVXVALOFZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|