C37H67N3O8 — CID 163506972
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate;1-O-methyl 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate (PubChem CID 163506972) has the molecular formula C37H67N3O8 and a molecular weight of 681.96 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate;1-O-methyl 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate;1-O-methyl 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 163506972 |
| Molecular Formula | C37H67N3O8 |
| Molecular Weight | 681.96 g/mol |
| Exact Mass | 681.49 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate;1-O-methyl 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C.COC(=O)CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C23H42N2O4.C14H25NO4/c1-20(2)12-16(13-21(3,4)24(20)9)28-18(26)11-19(27)29-17-14-22(5,6)25(10)23(7,8)15-17;1-13(2)8-10(9-14(3,4)15(13)5)19-12(17)7-11(16)18-6/h16-17H,11-15H2,1-10H3;10H,7-9H2,1-6H3 |
| InChIKey | CZJHFHINMDTDBC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|