C15H25N3O4 — CID 102089804
4-O-methyl 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazobutanedioate (PubChem CID 102089804) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-O-methyl 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazobutanedioate.
| Compound Name | 4-O-methyl 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazobutanedioate |
|---|---|
| PubChem CID | 102089804 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 4-O-methyl 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-diazobutanedioate |
| SMILES | COC(=O)CC(=[N+]=[N-])C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H25N3O4/c1-14(2)8-10(9-15(3,4)18(14)5)22-13(20)11(17-16)7-12(19)21-6/h10H,7-9H2,1-6H3 |
| InChIKey | NOAPBSMTTWXQIT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|