C23H46N2O2 — CID 158360818
1,2,2,4,6,6-hexamethylpiperidine;(1,2,2,6,6-pentamethylpiperidin-4-yl) acetate (PubChem CID 158360818) has the molecular formula C23H46N2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is 1,2,2,4,6,6-hexamethylpiperidine;(1,2,2,6,6-pentamethylpiperidin-4-yl) acetate.
| Compound Name | 1,2,2,4,6,6-hexamethylpiperidine;(1,2,2,6,6-pentamethylpiperidin-4-yl) acetate |
|---|---|
| PubChem CID | 158360818 |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | 1,2,2,4,6,6-hexamethylpiperidine;(1,2,2,6,6-pentamethylpiperidin-4-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1.CC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H23NO2.C11H23N/c1-9(14)15-10-7-11(2,3)13(6)12(4,5)8-10;1-9-7-10(2,3)12(6)11(4,5)8-9/h10H,7-8H2,1-6H3;9H,7-8H2,1-6H3 |
| InChIKey | GTLHNEDNKXNKFN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |