C12H27N — CID 159576451
1,2,2,4,6,6-hexamethylpiperidine;methane (PubChem CID 159576451) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 1,2,2,4,6,6-hexamethylpiperidine;methane.
| Compound Name | 1,2,2,4,6,6-hexamethylpiperidine;methane |
|---|---|
| PubChem CID | 159576451 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 1,2,2,4,6,6-hexamethylpiperidine;methane |
| SMILES | C.CC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H23N.CH4/c1-9-7-10(2,3)12(6)11(4,5)8-9;/h9H,7-8H2,1-6H3;1H4 |
| InChIKey | MILRNSWMJQLXPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |