C22H45N — CID 159311627
1,2,2,4,6,6-hexamethylpiperidine;1,1,3,3,5-pentamethylcyclohexane (PubChem CID 159311627) has the molecular formula C22H45N and a molecular weight of 323.61 g/mol. Its IUPAC name is 1,2,2,4,6,6-hexamethylpiperidine;1,1,3,3,5-pentamethylcyclohexane.
| Compound Name | 1,2,2,4,6,6-hexamethylpiperidine;1,1,3,3,5-pentamethylcyclohexane |
|---|---|
| PubChem CID | 159311627 |
| Molecular Formula | C22H45N |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 323.36 |
| IUPAC Name | 1,2,2,4,6,6-hexamethylpiperidine;1,1,3,3,5-pentamethylcyclohexane |
| SMILES | CC1CC(C)(C)CC(C)(C)C1.CC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H23N.C11H22/c1-9-7-10(2,3)12(6)11(4,5)8-9;1-9-6-10(2,3)8-11(4,5)7-9/h9H,7-8H2,1-6H3;9H,6-8H2,1-5H3 |
| InChIKey | LCPWAOIFEPHWMJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |