C15H29NO2 — CID 175054219
1,2,2,4,6,6-hexamethylpiperidine;2-methylprop-2-enoic acid (PubChem CID 175054219) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 1,2,2,4,6,6-hexamethylpiperidine;2-methylprop-2-enoic acid.
| Compound Name | 1,2,2,4,6,6-hexamethylpiperidine;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175054219 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 1,2,2,4,6,6-hexamethylpiperidine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H23N.C4H6O2/c1-9-7-10(2,3)12(6)11(4,5)8-9;1-3(2)4(5)6/h9H,7-8H2,1-6H3;1H2,2H3,(H,5,6) |
| InChIKey | STZCBMJBMDCUBZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|