C12H23NO — CID 59745323
1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanone (PubChem CID 59745323) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanone.
| Compound Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 59745323 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanone |
| SMILES | CC(=O)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H23NO/c1-9(14)10-7-11(2,3)13(6)12(4,5)8-10/h10H,7-8H2,1-6H3 |
| InChIKey | MUEVLKWIXCGRHH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |