C37H65N3O6 — CID 139317505
[2-(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxy-3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxycyclopentyl] 1,2,2,6,6-pentamethylpiperidine-4-carboxylate (PubChem CID 139317505) has the molecular formula C37H65N3O6 and a molecular weight of 647.94 g/mol. Its IUPAC name is [2-(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxy-3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxycyclopentyl] 1,2,2,6,6-pentamethylpiperidine-4-carboxylate.
| Compound Name | [2-(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxy-3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxycyclopentyl] 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 139317505 |
| Molecular Formula | C37H65N3O6 |
| Molecular Weight | 647.94 g/mol |
| Exact Mass | 647.49 |
| IUPAC Name | [2-(1,2,2,6,6-pentamethylpiperidine-4-carbonyl)oxy-3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxycyclopentyl] 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
| SMILES | CN1C(C)(C)CC(C(=O)OC2CCC(OC(=O)C3CC(C)(C)NC(C)(C)C3)C2OC(=O)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C37H65N3O6/c1-32(2)17-23(18-33(3,4)38-32)29(41)44-26-15-16-27(45-30(42)24-19-34(5,6)39(13)35(7,8)20-24)28(26)46-31(43)25-21-36(9,10)40(14)37(11,12)22-25/h23-28,38H,15-22H2,1-14H3 |
| InChIKey | LICVJRGQWXZARN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.94 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|