C46H80N4O8 — CID 139317427
[2,3,4-tris[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]cyclohexyl] 2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 139317427) has the molecular formula C46H80N4O8 and a molecular weight of 817.17 g/mol. Its IUPAC name is [2,3,4-tris[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]cyclohexyl] 2,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | [2,3,4-tris[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]cyclohexyl] 2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 139317427 |
| Molecular Formula | C46H80N4O8 |
| Molecular Weight | 817.17 g/mol |
| Exact Mass | 816.60 |
| IUPAC Name | [2,3,4-tris[(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy]cyclohexyl] 2,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CC1(C)CC(C(=O)OC2CCC(OC(=O)C3CC(C)(C)NC(C)(C)C3)C(OC(=O)C3CC(C)(C)NC(C)(C)C3)C2OC(=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C46H80N4O8/c1-39(2)19-27(20-40(3,4)47-39)35(51)55-31-17-18-32(56-36(52)28-21-41(5,6)48-42(7,8)22-28)34(58-38(54)30-25-45(13,14)50-46(15,16)26-30)33(31)57-37(53)29-23-43(9,10)49-44(11,12)24-29/h27-34,47-50H,17-26H2,1-16H3 |
| InChIKey | HQMMFYLBOIARRE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.17 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|