C24H46N2O5 — CID 155039441
3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxybutyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate (PubChem CID 155039441) has the molecular formula C24H46N2O5 and a molecular weight of 442.64 g/mol. Its IUPAC name is 3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxybutyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate.
| Compound Name | 3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxybutyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate |
|---|---|
| PubChem CID | 155039441 |
| Molecular Formula | C24H46N2O5 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 3-(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxybutyl 2,2,6,6-tetramethylpiperidine-4-carboxylate;hydrate |
| SMILES | CC(CCOC(=O)C1CC(C)(C)NC(C)(C)C1)OC(=O)C1CC(C)(C)NC(C)(C)C1.O |
| InChI | InChI=1S/C24H44N2O4.H2O/c1-16(30-20(28)18-14-23(6,7)26-24(8,9)15-18)10-11-29-19(27)17-12-21(2,3)25-22(4,5)13-17;/h16-18,25-26H,10-15H2,1-9H3;1H2 |
| InChIKey | DOHIXKGZJADCDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |