C25H46N2O4 — CID 138723922
7-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 138723922) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 7-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | 7-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138723922 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 7-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OCCCCCCCOC(=O)C2CC(C)(C)NC2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C25H46N2O4/c1-22(2)16-18(24(5,6)26-22)20(28)30-14-12-10-9-11-13-15-31-21(29)19-17-23(3,4)27-25(19,7)8/h18-19,26-27H,9-17H2,1-8H3 |
| InChIKey | NPOQQVWXQIEAKK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|