C39H69N3O9 — CID 138724284
2-[3,5-bis[2-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethoxy]cyclohexyl]oxyethyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 138724284) has the molecular formula C39H69N3O9 and a molecular weight of 723.99 g/mol. Its IUPAC name is 2-[3,5-bis[2-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethoxy]cyclohexyl]oxyethyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | 2-[3,5-bis[2-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethoxy]cyclohexyl]oxyethyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138724284 |
| Molecular Formula | C39H69N3O9 |
| Molecular Weight | 723.99 g/mol |
| Exact Mass | 723.50 |
| IUPAC Name | 2-[3,5-bis[2-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethoxy]cyclohexyl]oxyethyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OCCOC2CC(OCCOC(=O)C3CC(C)(C)NC3(C)C)CC(OCCOC(=O)C3CC(C)(C)NC3(C)C)C2)C(C)(C)N1 |
| InChI | InChI=1S/C39H69N3O9/c1-34(2)22-28(37(7,8)40-34)31(43)49-16-13-46-25-19-26(47-14-17-50-32(44)29-23-35(3,4)41-38(29,9)10)21-27(20-25)48-15-18-51-33(45)30-24-36(5,6)42-39(30,11)12/h25-30,40-42H,13-24H2,1-12H3 |
| InChIKey | IGWIBRIBZCFTTL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.99 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|