C32H56N2O4 — CID 138724207
[4-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxymethyl]cyclohexyl]cyclohexyl]methyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 138724207) has the molecular formula C32H56N2O4 and a molecular weight of 532.81 g/mol. Its IUPAC name is [4-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxymethyl]cyclohexyl]cyclohexyl]methyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | [4-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxymethyl]cyclohexyl]cyclohexyl]methyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138724207 |
| Molecular Formula | C32H56N2O4 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.42 |
| IUPAC Name | [4-[4-[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxymethyl]cyclohexyl]cyclohexyl]methyl 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OCC2CCC(C3CCC(COC(=O)C4CC(C)(C)NC4(C)C)CC3)CC2)C(C)(C)N1 |
| InChI | InChI=1S/C32H56N2O4/c1-29(2)17-25(31(5,6)33-29)27(35)37-19-21-9-13-23(14-10-21)24-15-11-22(12-16-24)20-38-28(36)26-18-30(3,4)34-32(26,7)8/h21-26,33-34H,9-20H2,1-8H3 |
| InChIKey | TVBBNTDZHVFGGA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |