C39H67N3O8 — CID 157121915
[1-(2,2,4,4-tetramethylcyclopentanecarbonyl)oxy-2,2-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]ethyl] 2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 157121915) has the molecular formula C39H67N3O8 and a molecular weight of 705.98 g/mol. Its IUPAC name is [1-(2,2,4,4-tetramethylcyclopentanecarbonyl)oxy-2,2-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]ethyl] 2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | [1-(2,2,4,4-tetramethylcyclopentanecarbonyl)oxy-2,2-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]ethyl] 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 157121915 |
| Molecular Formula | C39H67N3O8 |
| Molecular Weight | 705.98 g/mol |
| Exact Mass | 705.49 |
| IUPAC Name | [1-(2,2,4,4-tetramethylcyclopentanecarbonyl)oxy-2,2-bis[(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]ethyl] 2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OC(OC(=O)C2CC(C)(C)NC2(C)C)C(OC(=O)C2CC(C)(C)NC2(C)C)OC(=O)C2CC(C)(C)NC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C39H67N3O8/c1-32(2)17-22(33(3,4)21-32)26(43)47-30(48-27(44)23-18-34(5,6)40-37(23,11)12)31(49-28(45)24-19-35(7,8)41-38(24,13)14)50-29(46)25-20-36(9,10)42-39(25,15)16/h22-25,30-31,40-42H,17-21H2,1-16H3 |
| InChIKey | HCYXQUVWTKUACN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.98 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|