C41H72N4O11 — CID 146528006
[2,2-bis[(1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]-1-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethyl] 1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 146528006) has the molecular formula C41H72N4O11 and a molecular weight of 797.04 g/mol. Its IUPAC name is [2,2-bis[(1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]-1-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethyl] 1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | [2,2-bis[(1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]-1-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethyl] 1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 146528006 |
| Molecular Formula | C41H72N4O11 |
| Molecular Weight | 797.04 g/mol |
| Exact Mass | 796.52 |
| IUPAC Name | [2,2-bis[(1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxy]-1-(2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyethyl] 1-methoxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CON1C(C)(C)CC(C(=O)OC(OC(=O)C2CC(C)(C)NC2(C)C)C(OC(=O)C2CC(C)(C)N(OC)C2(C)C)OC(=O)C2CC(C)(C)N(OC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C41H72N4O11/c1-34(2)20-24(38(9,10)42-34)28(46)53-32(54-29(47)25-21-35(3,4)43(50-17)39(25,11)12)33(55-30(48)26-22-36(5,6)44(51-18)40(26,13)14)56-31(49)27-23-37(7,8)45(52-19)41(27,15)16/h24-27,32-33,42H,20-23H2,1-19H3 |
| InChIKey | DENDLDGHZDORJD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|