C29H52N4O2 — CID 138724229
[4-[1-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)piperidin-4-yl]piperidin-1-yl]-(2,2,5,5-tetramethylpyrrolidin-3-yl)methanone (PubChem CID 138724229) has the molecular formula C29H52N4O2 and a molecular weight of 488.76 g/mol. Its IUPAC name is [4-[1-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)piperidin-4-yl]piperidin-1-yl]-(2,2,5,5-tetramethylpyrrolidin-3-yl)methanone.
| Compound Name | [4-[1-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)piperidin-4-yl]piperidin-1-yl]-(2,2,5,5-tetramethylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 138724229 |
| Molecular Formula | C29H52N4O2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | [4-[1-(1,2,2,5,5-pentamethylpyrrolidine-3-carbonyl)piperidin-4-yl]piperidin-1-yl]-(2,2,5,5-tetramethylpyrrolidin-3-yl)methanone |
| SMILES | CN1C(C)(C)CC(C(=O)N2CCC(C3CCN(C(=O)C4CC(C)(C)NC4(C)C)CC3)CC2)C1(C)C |
| InChI | InChI=1S/C29H52N4O2/c1-26(2)18-22(28(5,6)30-26)24(34)32-14-10-20(11-15-32)21-12-16-33(17-13-21)25(35)23-19-27(3,4)31(9)29(23,7)8/h20-23,30H,10-19H2,1-9H3 |
| InChIKey | ALBCQXBEMVPVCP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |