C47H76N4O8 — CID 138724121
2-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 1-O,4-O,5-O-tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] benzene-1,2,4,5-tetracarboxylate (PubChem CID 138724121) has the molecular formula C47H76N4O8 and a molecular weight of 825.14 g/mol. Its IUPAC name is 2-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 1-O,4-O,5-O-tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] benzene-1,2,4,5-tetracarboxylate.
| Compound Name | 2-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 1-O,4-O,5-O-tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 138724121 |
| Molecular Formula | C47H76N4O8 |
| Molecular Weight | 825.14 g/mol |
| Exact Mass | 824.57 |
| IUPAC Name | 2-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 1-O,4-O,5-O-tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] benzene-1,2,4,5-tetracarboxylate |
| SMILES | CN1C(C)(C)CC(COC(=O)c2cc(C(=O)OCC3CC(C)(C)NC3(C)C)c(C(=O)OCC3CC(C)(C)NC3(C)C)cc2C(=O)OCC2CC(C)(C)NC2(C)C)C1(C)C |
| InChI | InChI=1S/C47H76N4O8/c1-40(2)20-28(44(9,10)48-40)24-56-36(52)32-18-34(38(54)58-26-30-22-42(5,6)50-46(30,13)14)35(39(55)59-27-31-23-43(7,8)51(17)47(31,15)16)19-33(32)37(53)57-25-29-21-41(3,4)49-45(29,11)12/h18-19,28-31,48-50H,20-27H2,1-17H3 |
| InChIKey | CWPMPYNHHPIIHQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.14 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|