C34H59N3O8 — CID 140895380
CID 140895380 (PubChem CID 140895380) has the molecular formula C34H59N3O8 and a molecular weight of 637.86 g/mol.
| Compound Name | CID 140895380 |
|---|---|
| PubChem CID | 140895380 |
| Molecular Formula | C34H59N3O8 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 637.43 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(COC(=O)CC(CC(=O)OCC2CC(C)(C)N([O])C2(C)C)CC(=O)OCC2CC(C)(C)N([O])C2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C34H59N3O8/c1-29(2)16-23(32(7,8)35-29)19-43-26(38)13-22(14-27(39)44-20-24-17-30(3,4)36(41)33(24,9)10)15-28(40)45-21-25-18-31(5,6)37(42)34(25,11)12/h22-25,35H,13-21H2,1-12H3 |
| InChIKey | OEMNUCRMQJIWIS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|