C37H69N3O9 — CID 138724250
bis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-[2-hydroxy-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]-4-methoxyheptanedioate (PubChem CID 138724250) has the molecular formula C37H69N3O9 and a molecular weight of 699.97 g/mol. Its IUPAC name is bis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-[2-hydroxy-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]-4-methoxyheptanedioate.
| Compound Name | bis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-[2-hydroxy-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]-4-methoxyheptanedioate |
|---|---|
| PubChem CID | 138724250 |
| Molecular Formula | C37H69N3O9 |
| Molecular Weight | 699.97 g/mol |
| Exact Mass | 699.50 |
| IUPAC Name | bis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-[2-hydroxy-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]-4-methoxyheptanedioate |
| SMILES | COC(CCC(=O)OCC1CC(C)(C)N(O)C1(C)C)(CCC(=O)OCC1CC(C)(C)N(O)C1(C)C)CC(O)OCC1CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C37H69N3O9/c1-31(2)18-25(34(7,8)38-31)22-49-30(43)21-37(46-13,16-14-28(41)47-23-26-19-32(3,4)39(44)35(26,9)10)17-15-29(42)48-24-27-20-33(5,6)40(45)36(27,11)12/h25-27,30,38,43-45H,14-24H2,1-13H3 |
| InChIKey | BPPRTCAEABRGFL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.97 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|