C43H74N4O10 — CID 140895329
CID 140895329 (PubChem CID 140895329) has the molecular formula C43H74N4O10 and a molecular weight of 807.08 g/mol.
| Compound Name | CID 140895329 |
|---|---|
| PubChem CID | 140895329 |
| Molecular Formula | C43H74N4O10 |
| Molecular Weight | 807.08 g/mol |
| Exact Mass | 806.54 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(COC(=O)C(CC(=O)OCC2CC(C)(C)N([O])C2(C)C)C(CC(=O)OC2CC(C)(C)N([O])C2(C)C)C(=O)OCC2CC(C)(C)NC2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C43H74N4O10/c1-36(2)19-26(40(9,10)44-36)23-55-34(50)29(17-32(48)54-25-28-21-38(5,6)46(52)42(28,13)14)30(35(51)56-24-27-20-37(3,4)45-41(27,11)12)18-33(49)57-31-22-39(7,8)47(53)43(31,15)16/h26-31,44-45H,17-25H2,1-16H3 |
| InChIKey | SVGQAMNGKWRBNX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.08 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|