C33H59N3O7 — CID 138723945
tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 138723945) has the molecular formula C33H59N3O7 and a molecular weight of 609.85 g/mol. Its IUPAC name is tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 138723945 |
| Molecular Formula | C33H59N3O7 |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.44 |
| IUPAC Name | tris[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC1(C)CC(COC(=O)CC(O)(CC(=O)OCC2CC(C)(C)NC2(C)C)C(=O)OCC2CC(C)(C)NC2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C33H59N3O7/c1-27(2)13-21(30(7,8)34-27)18-41-24(37)16-33(40,26(39)43-20-23-15-29(5,6)36-32(23,11)12)17-25(38)42-19-22-14-28(3,4)35-31(22,9)10/h21-23,34-36,40H,13-20H2,1-12H3 |
| InChIKey | STDMVXZGAUWLMS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|