C34H63N3O8 — CID 146527756
1-O-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 5-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 3-[2-hydroxy-2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]pentanedioate (PubChem CID 146527756) has the molecular formula C34H63N3O8 and a molecular weight of 641.89 g/mol. Its IUPAC name is 1-O-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 5-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 3-[2-hydroxy-2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]pentanedioate.
| Compound Name | 1-O-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 5-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 3-[2-hydroxy-2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]pentanedioate |
|---|---|
| PubChem CID | 146527756 |
| Molecular Formula | C34H63N3O8 |
| Molecular Weight | 641.89 g/mol |
| Exact Mass | 641.46 |
| IUPAC Name | 1-O-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 5-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 3-[2-hydroxy-2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]pentanedioate |
| SMILES | CC1(C)CC(COC(=O)CC(CC(=O)OCC2CC(C)(C)N(O)C2(C)C)CC(O)OCC2CC(C)(C)N(O)C2(C)C)C(C)(C)N1 |
| InChI | InChI=1S/C34H63N3O8/c1-29(2)16-23(32(7,8)35-29)19-43-26(38)13-22(14-27(39)44-20-24-17-30(3,4)36(41)33(24,9)10)15-28(40)45-21-25-18-31(5,6)37(42)34(25,11)12/h22-25,27,35,39,41-42H,13-21H2,1-12H3 |
| InChIKey | LRBDQZZANGAQQD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|