C38H69N3O7 — CID 140895320
1-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 7-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-methoxy-4-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]heptanedioate (PubChem CID 140895320) has the molecular formula C38H69N3O7 and a molecular weight of 679.98 g/mol. Its IUPAC name is 1-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 7-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-methoxy-4-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]heptanedioate.
| Compound Name | 1-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 7-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-methoxy-4-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]heptanedioate |
|---|---|
| PubChem CID | 140895320 |
| Molecular Formula | C38H69N3O7 |
| Molecular Weight | 679.98 g/mol |
| Exact Mass | 679.51 |
| IUPAC Name | 1-O-[(1,2,2,5,5-pentamethylpyrrolidin-3-yl)methyl] 7-O-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] 4-methoxy-4-[2-oxo-2-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methoxy]ethyl]heptanedioate |
| SMILES | COC(CCC(=O)OCC1CC(C)(C)NC1(C)C)(CCC(=O)OCC1CC(C)(C)N(C)C1(C)C)CC(=O)OCC1CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C38H69N3O7/c1-32(2)19-26(35(7,8)39-32)23-46-29(42)15-17-38(45-14,22-31(44)48-24-27-20-33(3,4)40-36(27,9)10)18-16-30(43)47-25-28-21-34(5,6)41(13)37(28,11)12/h26-28,39-40H,15-25H2,1-14H3 |
| InChIKey | JHVZWAZXIUDGNB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|