C42H72N4O12 — CID 138724239
tetrakis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] ethene-1,1,2,2-tetracarboxylate (PubChem CID 138724239) has the molecular formula C42H72N4O12 and a molecular weight of 825.05 g/mol. Its IUPAC name is tetrakis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] ethene-1,1,2,2-tetracarboxylate.
| Compound Name | tetrakis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] ethene-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 138724239 |
| Molecular Formula | C42H72N4O12 |
| Molecular Weight | 825.05 g/mol |
| Exact Mass | 824.51 |
| IUPAC Name | tetrakis[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl] ethene-1,1,2,2-tetracarboxylate |
| SMILES | CC1(C)CC(COC(=O)C(C(=O)OCC2CC(C)(C)N(O)C2(C)C)=C(C(=O)OCC2CC(C)(C)N(O)C2(C)C)C(=O)OCC2CC(C)(C)N(O)C2(C)C)C(C)(C)N1O |
| InChI | InChI=1S/C42H72N4O12/c1-35(2)17-25(39(9,10)43(35)51)21-55-31(47)29(32(48)56-22-26-18-36(3,4)44(52)40(26,11)12)30(33(49)57-23-27-19-37(5,6)45(53)41(27,13)14)34(50)58-24-28-20-38(7,8)46(54)42(28,15)16/h25-28,51-54H,17-24H2,1-16H3 |
| InChIKey | KGLFLDQZSNYRJW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 199.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|