C25H46N2O6 — CID 140895397
7-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 140895397) has the molecular formula C25H46N2O6 and a molecular weight of 470.65 g/mol. Its IUPAC name is 7-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | 7-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 140895397 |
| Molecular Formula | C25H46N2O6 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 7-(1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carbonyl)oxyheptyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)OCCCCCCCOC(=O)C2CC(C)(C)N(O)C2(C)C)C(C)(C)N1O |
| InChI | InChI=1S/C25H46N2O6/c1-22(2)16-18(24(5,6)26(22)30)20(28)32-14-12-10-9-11-13-15-33-21(29)19-17-23(3,4)27(31)25(19,7)8/h18-19,30-31H,9-17H2,1-8H3 |
| InChIKey | TUPWDKRYPZSHLO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|