butyl 2,2-dimethylcyclopropane-1-carboxylate

C10H18O2 — CID 12505854

IUPACbutyl 2,2-dimethylcyclopropane-1-carboxylate
SMILESCCCCOC(=O)C1CC1(C)C
InChIInChI=1S/C10H18O2/c1-4-5-6-12-9(11)8-7-10(8,2)3/h8H,4-7H2,1-3H3
InChIKeyBKMGKRVBNAAPFS-UHFFFAOYSA-N
MW170.25 g/mol
LogP2.38
Rot. Bonds4

About butyl 2,2-dimethylcyclopropane-1-carboxylate

butyl 2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 12505854) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is butyl 2,2-dimethylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namebutyl 2,2-dimethylcyclopropane-1-carboxylate
PubChem CID12505854
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Namebutyl 2,2-dimethylcyclopropane-1-carboxylate
SMILESCCCCOC(=O)C1CC1(C)C
InChIInChI=1S/C10H18O2/c1-4-5-6-12-9(11)8-7-10(8,2)3/h8H,4-7H2,1-3H3
InChIKeyBKMGKRVBNAAPFS-UHFFFAOYSA-N
XLogP2.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze butyl 2,2-dimethylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl 2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of butyl 2,2-dimethylcyclopropane-1-carboxylate (CID 12505854) is butyl 2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for butyl 2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for butyl 2,2-dimethylcyclopropane-1-carboxylate is CCCCOC(=O)C1CC1(C)C.
What is the InChIKey of butyl 2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is BKMGKRVBNAAPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-5-6-12-9(11)8-7-10(8,2)3/h8H,4-7H2,1-3H3.
What are the key properties of butyl 2,2-dimethylcyclopropane-1-carboxylate?
butyl 2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 170.25 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 12505854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).