C16H29NO4 — CID 70803881
trans-butyl (1S,3R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate (PubChem CID 70803881) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is trans-butyl (1S,3R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate.
| Compound Name | trans-butyl (1S,3R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 70803881 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | trans-butyl (1S,3R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C[C@@H](NC(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H29NO4/c1-7-8-9-20-13(18)11-10-12(16(11,5)6)17-14(19)21-15(2,3)4/h11-12H,7-10H2,1-6H3,(H,17,19)/t11-,12-/m1/s1 |
| InChIKey | UMCQLEUFEVMYQE-VXGBXAGGSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|