C16H28O4 — CID 66984653
1-O-butyl 4-O-tert-butyl cyclohexane-1,4-dicarboxylate (PubChem CID 66984653) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-O-butyl 4-O-tert-butyl cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-butyl 4-O-tert-butyl cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 66984653 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-O-butyl 4-O-tert-butyl cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)C1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28O4/c1-5-6-11-19-14(17)12-7-9-13(10-8-12)15(18)20-16(2,3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | BAAYLHBWFWVMDB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|