C15H26O4 — CID 66983945
4-O-tert-butyl 1-O-propyl cyclohexane-1,4-dicarboxylate (PubChem CID 66983945) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-propyl cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-propyl cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 66983945 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-propyl cyclohexane-1,4-dicarboxylate |
| SMILES | CCCOC(=O)C1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H26O4/c1-5-10-18-13(16)11-6-8-12(9-7-11)14(17)19-15(2,3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | KJSLYSCWFMRMQG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |